![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Combat Formations.pdf | 2022-02-16 12:49 | 4.4M | |
| Combat Intelligence.pdf | 2022-02-16 12:49 | 1.2M | |
| Cover and Concealment.pdf | 2022-02-16 12:49 | 2.0M | |
| Defensive Weapons Employment.pdf | 2022-02-16 12:49 | 2.0M | |
| Field Fortifications.pdf | 2022-02-16 12:49 | 2.3M | |
| Field Sanitation.pdf | 2022-02-16 12:49 | 2.8M | |
| Field Sketching.pdf | 2022-02-16 12:49 | 2.9M | |
| First Aid.pdf | 2022-02-16 12:49 | 2.9M | |
| Glossary.pdf | 2022-02-16 12:49 | 9.6M | |
| Immediate Action Drills.pdf | 2022-02-16 12:49 | 2.2M | |
| Individual Weapons Training.pdf | 2022-02-16 12:49 | 3.0M | |
| Initial Briefing to the Guerrillas.pdf | 2022-02-16 12:49 | 821K | |
| Mines and Booby Traps.pdf | 2022-02-16 12:49 | 3.0M | |
| Nuclear,Biological & Chemical Defense.pdf | 2022-02-16 12:49 | 3.2M | |
| Passive and Active Air Defense.pdf | 2022-02-16 12:49 | 1.7M | |
| Quizzes.pdf | 2022-02-16 12:49 | 3.3M | |
| Security and Interior Guard.pdf | 2022-02-16 12:49 | 2.5M | |
| Vol 03 Less 25-36.pdf | 2022-02-16 12:49 | 7.4M | |
| Vol 04 Less 37-48.pdf | 2022-02-16 12:49 | 7.4M | |