![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Combat Formations.pdf | 2022-02-16 12:51 | 4.2M | |
| Cover and Concealment.pdf | 2022-02-16 12:51 | 2.9M | |
| Defensive Weapons Employment.pdf | 2022-02-16 12:51 | 2.6M | |
| Field Fortifications.pdf | 2022-02-16 12:51 | 4.5M | |
| Field Sketching.pdf | 2022-02-16 12:51 | 4.3M | |
| First Aid.pdf | 2022-02-16 12:51 | 7.9M | |
| Initial Briefing to the Guerrillas.pdf | 2022-02-16 12:51 | 2.0M | |
| Mines & Booby Traps.pdf | 2022-02-16 12:51 | 6.8M | |
| Nuclear, Biological & Chemical Defense.pdf | 2022-02-16 12:51 | 3.7M | |
| Passive and Active Air Defense.pdf | 2022-02-16 12:51 | 2.6M | |
| Vol III Part II.pdf | 2022-02-16 12:51 | 6.1M | |
| Vol III part I.pdf | 2022-02-16 12:51 | 7.8M | |