![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Course Manual.pdf | 2022-02-16 12:49 | 365K | |
| Miscellaneous Losses and Replacements.pdf | 2022-02-16 12:49 | 2.0M | |
| Miscellaneous-Callsigns,Frequencies, & Passwords.pdf | 2022-02-16 12:49 | 2.2M | |
| Termination of Interrogation.pdf | 2022-02-16 12:49 | 2.2M | |
| Miscellaneous-Obstacles.pdf | 2022-02-16 12:49 | 2.3M | |
| Logistics-Food & Water.pdf | 2022-02-16 12:49 | 2.4M | |
| Miscellaneous-Tactics & Training 02.pdf | 2022-02-16 12:49 | 2.5M | |
| Logistics-Vehicles,Pertoleum,Oil & Lubricants.pdf | 2022-02-16 12:49 | 2.6M | |
| Miscellaneous-Tactics & Training 01.pdf | 2022-02-16 12:49 | 2.7M | |
| Miscellaneous-Tactics & Training 03.pdf | 2022-02-16 12:49 | 2.8M | |
| Logistics-Medical.pdf | 2022-02-16 12:49 | 2.8M | |
| Miscellaneous-Callsigns,Frequencies, & Passwords 01.pdf | 2022-02-16 12:49 | 3.1M | |
| Logistics-Nuclear Biological & Chemical.pdf | 2022-02-16 12:49 | 3.2M | |
| Logistics Communications Equipment.pdf | 2022-02-16 12:49 | 3.5M | |
| Logistics-Weapons & Ammunitions.pdf | 2022-02-16 12:49 | 3.6M | |
| Mission.pdf | 2022-02-16 12:49 | 6.5M | |
|
|---|